C21H19F6N3O4 — CID 25022915
methyl (2E)-2-[2-[[[C-[3,5-bis(trifluoromethyl)phenyl]-N-methylcarbonimidoyl]amino]oxymethyl]phenyl]-2-methoxyiminoacetate (PubChem CID 25022915) has the molecular formula C21H19F6N3O4 and a molecular weight of 491.39 g/mol. Its IUPAC name is methyl (2E)-2-[2-[[[C-[3,5-bis(trifluoromethyl)phenyl]-N-methylcarbonimidoyl]amino]oxymethyl]phenyl]-2-methoxyiminoacetate.
| Compound Name | methyl (2E)-2-[2-[[[C-[3,5-bis(trifluoromethyl)phenyl]-N-methylcarbonimidoyl]amino]oxymethyl]phenyl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 25022915 |
| Molecular Formula | C21H19F6N3O4 |
| Molecular Weight | 491.39 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | methyl (2E)-2-[2-[[[C-[3,5-bis(trifluoromethyl)phenyl]-N-methylcarbonimidoyl]amino]oxymethyl]phenyl]-2-methoxyiminoacetate |
| SMILES | C/N=C(\NOCc1ccccc1/C(=N\OC)C(=O)OC)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H19F6N3O4/c1-28-18(13-8-14(20(22,23)24)10-15(9-13)21(25,26)27)30-34-11-12-6-4-5-7-16(12)17(29-33-3)19(31)32-2/h4-10H,11H2,1-3H3,(H,28,30)/b29-17+ |
| InChIKey | CYEWQNYGDQDWTF-STBIYBPSSA-N |
| XLogP | 4.35 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|