C15H16Cl3NO2 — CID 25023120
2,2,2-trichloro-1-[(2S)-2-[(Z)-2-phenylmethoxyethenyl]pyrrolidin-1-yl]ethanone (PubChem CID 25023120) has the molecular formula C15H16Cl3NO2 and a molecular weight of 348.66 g/mol. Its IUPAC name is 2,2,2-trichloro-1-[(2S)-2-[(Z)-2-phenylmethoxyethenyl]pyrrolidin-1-yl]ethanone.
| Compound Name | 2,2,2-trichloro-1-[(2S)-2-[(Z)-2-phenylmethoxyethenyl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 25023120 |
| Molecular Formula | C15H16Cl3NO2 |
| Molecular Weight | 348.66 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 2,2,2-trichloro-1-[(2S)-2-[(Z)-2-phenylmethoxyethenyl]pyrrolidin-1-yl]ethanone |
| SMILES | O=C(N1CCC[C@H]1/C=C\OCc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H16Cl3NO2/c16-15(17,18)14(20)19-9-4-7-13(19)8-10-21-11-12-5-2-1-3-6-12/h1-3,5-6,8,10,13H,4,7,9,11H2/b10-8-/t13-/m0/s1 |
| InChIKey | CSCAOZBSUQCCPC-KJJQSCHISA-N |
| XLogP | 4.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.66 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|