C17H12BrFN2OS2 — CID 25024005
S-(2-bromophenyl) 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]ethanethioate (PubChem CID 25024005) has the molecular formula C17H12BrFN2OS2 and a molecular weight of 423.33 g/mol. Its IUPAC name is S-(2-bromophenyl) 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]ethanethioate.
| Compound Name | S-(2-bromophenyl) 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]ethanethioate |
|---|---|
| PubChem CID | 25024005 |
| Molecular Formula | C17H12BrFN2OS2 |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 421.96 |
| IUPAC Name | S-(2-bromophenyl) 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]ethanethioate |
| SMILES | O=C(CNc1nc(-c2ccc(F)cc2)cs1)Sc1ccccc1Br |
| InChI | InChI=1S/C17H12BrFN2OS2/c18-13-3-1-2-4-15(13)24-16(22)9-20-17-21-14(10-23-17)11-5-7-12(19)8-6-11/h1-8,10H,9H2,(H,20,21) |
| InChIKey | BLHVIBCFYSYVTO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|