C18H17FN2OS2 — CID 133372575
N-(2-benzylsulfinylethyl)-4-(4-fluorophenyl)-1,3-thiazol-2-amine (PubChem CID 133372575) has the molecular formula C18H17FN2OS2 and a molecular weight of 360.48 g/mol. Its IUPAC name is N-(2-benzylsulfinylethyl)-4-(4-fluorophenyl)-1,3-thiazol-2-amine.
| Compound Name | N-(2-benzylsulfinylethyl)-4-(4-fluorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 133372575 |
| Molecular Formula | C18H17FN2OS2 |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-(2-benzylsulfinylethyl)-4-(4-fluorophenyl)-1,3-thiazol-2-amine |
| SMILES | O=S(CCNc1nc(-c2ccc(F)cc2)cs1)Cc1ccccc1 |
| InChI | InChI=1S/C18H17FN2OS2/c19-16-8-6-15(7-9-16)17-12-23-18(21-17)20-10-11-24(22)13-14-4-2-1-3-5-14/h1-9,12H,10-11,13H2,(H,20,21) |
| InChIKey | YGQREWJVQLQCAC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |