C23H21ClN6O2 — CID 25024934
6-chloro-N-[4-[[[6-methoxy-2-(methylamino)quinazolin-4-yl]amino]methyl]phenyl]pyridine-3-carboxamide (PubChem CID 25024934) has the molecular formula C23H21ClN6O2 and a molecular weight of 448.91 g/mol. Its IUPAC name is 6-chloro-N-[4-[[[6-methoxy-2-(methylamino)quinazolin-4-yl]amino]methyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[4-[[[6-methoxy-2-(methylamino)quinazolin-4-yl]amino]methyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 25024934 |
| Molecular Formula | C23H21ClN6O2 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 6-chloro-N-[4-[[[6-methoxy-2-(methylamino)quinazolin-4-yl]amino]methyl]phenyl]pyridine-3-carboxamide |
| SMILES | CNc1nc(NCc2ccc(NC(=O)c3ccc(Cl)nc3)cc2)c2cc(OC)ccc2n1 |
| InChI | InChI=1S/C23H21ClN6O2/c1-25-23-29-19-9-8-17(32-2)11-18(19)21(30-23)27-12-14-3-6-16(7-4-14)28-22(31)15-5-10-20(24)26-13-15/h3-11,13H,12H2,1-2H3,(H,28,31)(H2,25,27,29,30) |
| InChIKey | SUVBBDVKWJSHLL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|