C23H31N5 — CID 25026058
7-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]-1,4,5,6-tetrahydropyrazolo[5,4-b]pyridine (PubChem CID 25026058) has the molecular formula C23H31N5 and a molecular weight of 377.54 g/mol. Its IUPAC name is 7-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]-1,4,5,6-tetrahydropyrazolo[5,4-b]pyridine.
| Compound Name | 7-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]-1,4,5,6-tetrahydropyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 25026058 |
| Molecular Formula | C23H31N5 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | 7-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]-1,4,5,6-tetrahydropyrazolo[5,4-b]pyridine |
| SMILES | CCC(C)(C)Cc1cnc(CCc2ccc(N3CCCc4cn[nH]c43)cc2)[nH]1 |
| InChI | InChI=1S/C23H31N5/c1-4-23(2,3)14-19-16-24-21(26-19)12-9-17-7-10-20(11-8-17)28-13-5-6-18-15-25-27-22(18)28/h7-8,10-11,15-16H,4-6,9,12-14H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | BZQGYQLMMTVEDK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |