C17H16O7 — CID 25026150
[(4S,5S,6R,7S,11S)-6,8-dihydroxy-6-methyl-2-oxo-3,9-dioxatricyclo[5.3.1.04,11]undec-1(10)-en-5-yl] benzoate (PubChem CID 25026150) has the molecular formula C17H16O7 and a molecular weight of 332.31 g/mol. Its IUPAC name is [(4S,5S,6R,7S,11S)-6,8-dihydroxy-6-methyl-2-oxo-3,9-dioxatricyclo[5.3.1.04,11]undec-1(10)-en-5-yl] benzoate.
| Compound Name | [(4S,5S,6R,7S,11S)-6,8-dihydroxy-6-methyl-2-oxo-3,9-dioxatricyclo[5.3.1.04,11]undec-1(10)-en-5-yl] benzoate |
|---|---|
| PubChem CID | 25026150 |
| Molecular Formula | C17H16O7 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | [(4S,5S,6R,7S,11S)-6,8-dihydroxy-6-methyl-2-oxo-3,9-dioxatricyclo[5.3.1.04,11]undec-1(10)-en-5-yl] benzoate |
| SMILES | C[C@]1(O)[C@@H](OC(=O)c2ccccc2)[C@H]2OC(=O)C3=COC(O)[C@H]1[C@@H]32 |
| InChI | InChI=1S/C17H16O7/c1-17(21)11-10-9(7-22-16(11)20)15(19)23-12(10)13(17)24-14(18)8-5-3-2-4-6-8/h2-7,10-13,16,20-21H,1H3/t10-,11-,12+,13+,16?,17-/m1/s1 |
| InChIKey | SOKURYHBAZNKLQ-JOLPSSOESA-N |
| XLogP | 0.37 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |