C17H17ClF3N3O2S — CID 25027960
3-[6-chloro-2,2-dioxo-1-(2,4,6-trifluorophenyl)-4H-2λ6,1,3-benzothiadiazin-3-yl]-N-methylpropan-1-amine (PubChem CID 25027960) has the molecular formula C17H17ClF3N3O2S and a molecular weight of 419.86 g/mol. Its IUPAC name is 3-[6-chloro-2,2-dioxo-1-(2,4,6-trifluorophenyl)-4H-2λ6,1,3-benzothiadiazin-3-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[6-chloro-2,2-dioxo-1-(2,4,6-trifluorophenyl)-4H-2λ6,1,3-benzothiadiazin-3-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 25027960 |
| Molecular Formula | C17H17ClF3N3O2S |
| Molecular Weight | 419.86 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 3-[6-chloro-2,2-dioxo-1-(2,4,6-trifluorophenyl)-4H-2λ6,1,3-benzothiadiazin-3-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCN1Cc2cc(Cl)ccc2N(c2c(F)cc(F)cc2F)S1(=O)=O |
| InChI | InChI=1S/C17H17ClF3N3O2S/c1-22-5-2-6-23-10-11-7-12(18)3-4-16(11)24(27(23,25)26)17-14(20)8-13(19)9-15(17)21/h3-4,7-9,22H,2,5-6,10H2,1H3 |
| InChIKey | RUXJSFHYHXEQJV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.86 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|