C17H19ClN2O2S — CID 68584013
3-(3-chloropropyl)-1-(3-methylphenyl)-4H-2λ6,1,3-benzothiadiazine 2,2-dioxide (PubChem CID 68584013) has the molecular formula C17H19ClN2O2S and a molecular weight of 350.87 g/mol. Its IUPAC name is 3-(3-chloropropyl)-1-(3-methylphenyl)-4H-2λ6,1,3-benzothiadiazine 2,2-dioxide.
| Compound Name | 3-(3-chloropropyl)-1-(3-methylphenyl)-4H-2λ6,1,3-benzothiadiazine 2,2-dioxide |
|---|---|
| PubChem CID | 68584013 |
| Molecular Formula | C17H19ClN2O2S |
| Molecular Weight | 350.87 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 3-(3-chloropropyl)-1-(3-methylphenyl)-4H-2λ6,1,3-benzothiadiazine 2,2-dioxide |
| SMILES | Cc1cccc(N2c3ccccc3CN(CCCCl)S2(=O)=O)c1 |
| InChI | InChI=1S/C17H19ClN2O2S/c1-14-6-4-8-16(12-14)20-17-9-3-2-7-15(17)13-19(11-5-10-18)23(20,21)22/h2-4,6-9,12H,5,10-11,13H2,1H3 |
| InChIKey | OBBIVGVCYGAKJP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.87 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|