C16H18ClF2N3O2S — CID 69251390
3-[3-(2,4-difluorophenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]-N-methylpropan-1-amine;hydrochloride (PubChem CID 69251390) has the molecular formula C16H18ClF2N3O2S and a molecular weight of 389.86 g/mol. Its IUPAC name is 3-[3-(2,4-difluorophenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]-N-methylpropan-1-amine;hydrochloride.
| Compound Name | 3-[3-(2,4-difluorophenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]-N-methylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 69251390 |
| Molecular Formula | C16H18ClF2N3O2S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 3-[3-(2,4-difluorophenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]-N-methylpropan-1-amine;hydrochloride |
| SMILES | CNCCCN1c2ccccc2N(c2ccc(F)cc2F)S1(=O)=O.Cl |
| InChI | InChI=1S/C16H17F2N3O2S.ClH/c1-19-9-4-10-20-15-5-2-3-6-16(15)21(24(20,22)23)14-8-7-12(17)11-13(14)18;/h2-3,5-8,11,19H,4,9-10H2,1H3;1H |
| InChIKey | JZNWJSGNYVCTSO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|