C18H21F2N3O2S — CID 71091010
3-[3-(2,3-difluoro-4-methylphenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]-N-ethylpropan-1-amine (PubChem CID 71091010) has the molecular formula C18H21F2N3O2S and a molecular weight of 381.45 g/mol. Its IUPAC name is 3-[3-(2,3-difluoro-4-methylphenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]-N-ethylpropan-1-amine.
| Compound Name | 3-[3-(2,3-difluoro-4-methylphenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 71091010 |
| Molecular Formula | C18H21F2N3O2S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 3-[3-(2,3-difluoro-4-methylphenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]-N-ethylpropan-1-amine |
| SMILES | CCNCCCN1c2ccccc2N(c2ccc(C)c(F)c2F)S1(=O)=O |
| InChI | InChI=1S/C18H21F2N3O2S/c1-3-21-11-6-12-22-14-7-4-5-8-15(14)23(26(22,24)25)16-10-9-13(2)17(19)18(16)20/h4-5,7-10,21H,3,6,11-12H2,1-2H3 |
| InChIKey | GJKAKDLIBBONJS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|