C18H20ClF2N3O2S — CID 69248628
N-[3-[3-(2,4-difluorophenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]propyl]cyclopropanamine;hydrochloride (PubChem CID 69248628) has the molecular formula C18H20ClF2N3O2S and a molecular weight of 415.89 g/mol. Its IUPAC name is N-[3-[3-(2,4-difluorophenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]propyl]cyclopropanamine;hydrochloride.
| Compound Name | N-[3-[3-(2,4-difluorophenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]propyl]cyclopropanamine;hydrochloride |
|---|---|
| PubChem CID | 69248628 |
| Molecular Formula | C18H20ClF2N3O2S |
| Molecular Weight | 415.89 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N-[3-[3-(2,4-difluorophenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]propyl]cyclopropanamine;hydrochloride |
| SMILES | Cl.O=S1(=O)N(CCCNC2CC2)c2ccccc2N1c1ccc(F)cc1F |
| InChI | InChI=1S/C18H19F2N3O2S.ClH/c19-13-6-9-16(15(20)12-13)23-18-5-2-1-4-17(18)22(26(23,24)25)11-3-10-21-14-7-8-14;/h1-2,4-6,9,12,14,21H,3,7-8,10-11H2;1H |
| InChIKey | CNMLPFITMVSJFP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.89 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|