C20H29Cl2FN4O2S — CID 69251992
N-[3-[3-(2-fluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]propyl]piperidin-4-amine;dihydrochloride (PubChem CID 69251992) has the molecular formula C20H29Cl2FN4O2S and a molecular weight of 479.45 g/mol. Its IUPAC name is N-[3-[3-(2-fluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]propyl]piperidin-4-amine;dihydrochloride.
| Compound Name | N-[3-[3-(2-fluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]propyl]piperidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 69251992 |
| Molecular Formula | C20H29Cl2FN4O2S |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | N-[3-[3-(2-fluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]propyl]piperidin-4-amine;dihydrochloride |
| SMILES | Cl.Cl.OS1(O)N(CCCNC2CCNCC2)c2ccccc2N1c1ccccc1F |
| InChI | InChI=1S/C20H27FN4O2S.2ClH/c21-17-6-1-2-7-18(17)25-20-9-4-3-8-19(20)24(28(25,26)27)15-5-12-23-16-10-13-22-14-11-16;;/h1-4,6-9,16,22-23,26-27H,5,10-15H2;2*1H |
| InChIKey | NDLTZGKWUHLTAR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|