C16H20FN3O2S — CID 68898756
4-[3-(2-fluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]butan-1-amine (PubChem CID 68898756) has the molecular formula C16H20FN3O2S and a molecular weight of 337.42 g/mol. Its IUPAC name is 4-[3-(2-fluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]butan-1-amine.
| Compound Name | 4-[3-(2-fluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 68898756 |
| Molecular Formula | C16H20FN3O2S |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 4-[3-(2-fluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]butan-1-amine |
| SMILES | NCCCCN1c2ccccc2N(c2ccccc2F)S1(O)O |
| InChI | InChI=1S/C16H20FN3O2S/c17-13-7-1-2-8-14(13)20-16-10-4-3-9-15(16)19(23(20,21)22)12-6-5-11-18/h1-4,7-10,21-22H,5-6,11-12,18H2 |
| InChIKey | NQOXMSGKCSBZSE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|