C18H25N3O2S — CID 143693852
4-(2,2-dioxo-3-phenyl-2λ6,1,3-benzothiadiazol-1-yl)butan-1-amine;ethane (PubChem CID 143693852) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is 4-(2,2-dioxo-3-phenyl-2λ6,1,3-benzothiadiazol-1-yl)butan-1-amine;ethane.
| Compound Name | 4-(2,2-dioxo-3-phenyl-2λ6,1,3-benzothiadiazol-1-yl)butan-1-amine;ethane |
|---|---|
| PubChem CID | 143693852 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 4-(2,2-dioxo-3-phenyl-2λ6,1,3-benzothiadiazol-1-yl)butan-1-amine;ethane |
| SMILES | CC.NCCCCN1c2ccccc2N(c2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C16H19N3O2S.C2H6/c17-12-6-7-13-18-15-10-4-5-11-16(15)19(22(18,20)21)14-8-2-1-3-9-14;1-2/h1-5,8-11H,6-7,12-13,17H2;1-2H3 |
| InChIKey | WSGYWSLTJMMZIV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|