C17H18FN3O2S — CID 68712124
4-[3-(2-fluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]-N-methylbut-2-yn-1-amine (PubChem CID 68712124) has the molecular formula C17H18FN3O2S and a molecular weight of 347.42 g/mol. Its IUPAC name is 4-[3-(2-fluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]-N-methylbut-2-yn-1-amine.
| Compound Name | 4-[3-(2-fluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]-N-methylbut-2-yn-1-amine |
|---|---|
| PubChem CID | 68712124 |
| Molecular Formula | C17H18FN3O2S |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 4-[3-(2-fluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]-N-methylbut-2-yn-1-amine |
| SMILES | CNCC#CCN1c2ccccc2N(c2ccccc2F)S1(O)O |
| InChI | InChI=1S/C17H18FN3O2S/c1-19-12-6-7-13-20-16-10-4-5-11-17(16)21(24(20,22)23)15-9-3-2-8-14(15)18/h2-5,8-11,19,22-23H,12-13H2,1H3 |
| InChIKey | IDRXOTBBUZKKAE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|