C19H24FN3O2S — CID 68895501
N-[4-[3-(2-fluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]butyl]cyclopropanamine (PubChem CID 68895501) has the molecular formula C19H24FN3O2S and a molecular weight of 377.48 g/mol. Its IUPAC name is N-[4-[3-(2-fluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]butyl]cyclopropanamine.
| Compound Name | N-[4-[3-(2-fluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]butyl]cyclopropanamine |
|---|---|
| PubChem CID | 68895501 |
| Molecular Formula | C19H24FN3O2S |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-[4-[3-(2-fluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]butyl]cyclopropanamine |
| SMILES | OS1(O)N(CCCCNC2CC2)c2ccccc2N1c1ccccc1F |
| InChI | InChI=1S/C19H24FN3O2S/c20-16-7-1-2-8-17(16)23-19-10-4-3-9-18(19)22(26(23,24)25)14-6-5-13-21-15-11-12-15/h1-4,7-10,15,21,24-25H,5-6,11-14H2 |
| InChIKey | RMBNDTZOAUVSNP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|