C24H33FN4O2S — CID 91458878
1-tert-butyl-N-[3-[3-(2-fluorophenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]propyl]piperidin-4-amine (PubChem CID 91458878) has the molecular formula C24H33FN4O2S and a molecular weight of 460.62 g/mol. Its IUPAC name is 1-tert-butyl-N-[3-[3-(2-fluorophenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]propyl]piperidin-4-amine.
| Compound Name | 1-tert-butyl-N-[3-[3-(2-fluorophenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]propyl]piperidin-4-amine |
|---|---|
| PubChem CID | 91458878 |
| Molecular Formula | C24H33FN4O2S |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 1-tert-butyl-N-[3-[3-(2-fluorophenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]propyl]piperidin-4-amine |
| SMILES | CC(C)(C)N1CCC(NCCCN2c3ccccc3N(c3ccccc3F)S2(=O)=O)CC1 |
| InChI | InChI=1S/C24H33FN4O2S/c1-24(2,3)27-17-13-19(14-18-27)26-15-8-16-28-22-11-6-7-12-23(22)29(32(28,30)31)21-10-5-4-9-20(21)25/h4-7,9-12,19,26H,8,13-18H2,1-3H3 |
| InChIKey | CXAUYUVHHRYFFL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|