C19H23F2N3O2S — CID 68894792
N-[3-[3-(2,6-difluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]propyl]cyclobutanamine (PubChem CID 68894792) has the molecular formula C19H23F2N3O2S and a molecular weight of 395.48 g/mol. Its IUPAC name is N-[3-[3-(2,6-difluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]propyl]cyclobutanamine.
| Compound Name | N-[3-[3-(2,6-difluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]propyl]cyclobutanamine |
|---|---|
| PubChem CID | 68894792 |
| Molecular Formula | C19H23F2N3O2S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-[3-[3-(2,6-difluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]propyl]cyclobutanamine |
| SMILES | OS1(O)N(CCCNC2CCC2)c2ccccc2N1c1c(F)cccc1F |
| InChI | InChI=1S/C19H23F2N3O2S/c20-15-8-4-9-16(21)19(15)24-18-11-2-1-10-17(18)23(27(24,25)26)13-5-12-22-14-6-3-7-14/h1-2,4,8-11,14,22,25-26H,3,5-7,12-13H2 |
| InChIKey | ICMOYSNFWIOZBQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|