C21H27F2N3O3S — CID 68711067
N-[2-[2-[3-(2,6-difluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]ethoxy]ethyl]cyclopentanamine (PubChem CID 68711067) has the molecular formula C21H27F2N3O3S and a molecular weight of 439.53 g/mol. Its IUPAC name is N-[2-[2-[3-(2,6-difluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]ethoxy]ethyl]cyclopentanamine.
| Compound Name | N-[2-[2-[3-(2,6-difluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]ethoxy]ethyl]cyclopentanamine |
|---|---|
| PubChem CID | 68711067 |
| Molecular Formula | C21H27F2N3O3S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N-[2-[2-[3-(2,6-difluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]ethoxy]ethyl]cyclopentanamine |
| SMILES | OS1(O)N(CCOCCNC2CCCC2)c2ccccc2N1c1c(F)cccc1F |
| InChI | InChI=1S/C21H27F2N3O3S/c22-17-8-5-9-18(23)21(17)26-20-11-4-3-10-19(20)25(30(26,27)28)13-15-29-14-12-24-16-6-1-2-7-16/h3-5,8-11,16,24,27-28H,1-2,6-7,12-15H2 |
| InChIKey | VXDSZFHUEDIXEM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 68.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|