C18H23F2N3O2S — CID 69248887
3-[3-(2,6-difluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]-N-propan-2-ylpropan-1-amine (PubChem CID 69248887) has the molecular formula C18H23F2N3O2S and a molecular weight of 383.46 g/mol. Its IUPAC name is 3-[3-(2,6-difluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-[3-(2,6-difluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 69248887 |
| Molecular Formula | C18H23F2N3O2S |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 3-[3-(2,6-difluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]-N-propan-2-ylpropan-1-amine |
| SMILES | CC(C)NCCCN1c2ccccc2N(c2c(F)cccc2F)S1(O)O |
| InChI | InChI=1S/C18H23F2N3O2S/c1-13(2)21-11-6-12-22-16-9-3-4-10-17(16)23(26(22,24)25)18-14(19)7-5-8-15(18)20/h3-5,7-10,13,21,24-25H,6,11-12H2,1-2H3 |
| InChIKey | YNSVLPGBYTZNPR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|