C19H25FN4O4S — CID 68708215
3-[2-[3-(2-fluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]ethyl-methylamino]propylcarbamic acid (PubChem CID 68708215) has the molecular formula C19H25FN4O4S and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-[2-[3-(2-fluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]ethyl-methylamino]propylcarbamic acid.
| Compound Name | 3-[2-[3-(2-fluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]ethyl-methylamino]propylcarbamic acid |
|---|---|
| PubChem CID | 68708215 |
| Molecular Formula | C19H25FN4O4S |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 3-[2-[3-(2-fluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]ethyl-methylamino]propylcarbamic acid |
| SMILES | CN(CCCNC(=O)O)CCN1c2ccccc2N(c2ccccc2F)S1(O)O |
| InChI | InChI=1S/C19H25FN4O4S/c1-22(12-6-11-21-19(25)26)13-14-23-17-9-4-5-10-18(17)24(29(23,27)28)16-8-3-2-7-15(16)20/h2-5,7-10,21,27-28H,6,11-14H2,1H3,(H,25,26) |
| InChIKey | YFVYJHMHWIQMAU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|