C16H20N4O2S — CID 24936873
N-methyl-3-[3-(3-methyl-2-pyridinyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]propan-1-amine (PubChem CID 24936873) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is N-methyl-3-[3-(3-methyl-2-pyridinyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]propan-1-amine.
| Compound Name | N-methyl-3-[3-(3-methyl-2-pyridinyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 24936873 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-methyl-3-[3-(3-methyl-2-pyridinyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]propan-1-amine |
| SMILES | CNCCCN1c2ccccc2N(c2ncccc2C)S1(=O)=O |
| InChI | InChI=1S/C16H20N4O2S/c1-13-7-5-11-18-16(13)20-15-9-4-3-8-14(15)19(23(20,21)22)12-6-10-17-2/h3-5,7-9,11,17H,6,10,12H2,1-2H3 |
| InChIKey | SVPPENDPIZRCGI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|