C17H23N3O2S — CID 68894600
3-(2,2-dihydroxy-4-methyl-3-phenyl-2λ4,1,3-benzothiadiazol-1-yl)-N-methylpropan-1-amine (PubChem CID 68894600) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is 3-(2,2-dihydroxy-4-methyl-3-phenyl-2λ4,1,3-benzothiadiazol-1-yl)-N-methylpropan-1-amine.
| Compound Name | 3-(2,2-dihydroxy-4-methyl-3-phenyl-2λ4,1,3-benzothiadiazol-1-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 68894600 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 3-(2,2-dihydroxy-4-methyl-3-phenyl-2λ4,1,3-benzothiadiazol-1-yl)-N-methylpropan-1-amine |
| SMILES | CNCCCN1c2cccc(C)c2N(c2ccccc2)S1(O)O |
| InChI | InChI=1S/C17H23N3O2S/c1-14-8-6-11-16-17(14)20(15-9-4-3-5-10-15)23(21,22)19(16)13-7-12-18-2/h3-6,8-11,18,21-22H,7,12-13H2,1-2H3 |
| InChIKey | JVIAZRAUZPIAPI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|