C18H26ClN3O2S — CID 68583718
3-[2,2-dihydroxy-1-(4-methylphenyl)-4H-2λ4,1,3-benzothiadiazin-3-yl]-N-methylpropan-1-amine;hydrochloride (PubChem CID 68583718) has the molecular formula C18H26ClN3O2S and a molecular weight of 383.95 g/mol. Its IUPAC name is 3-[2,2-dihydroxy-1-(4-methylphenyl)-4H-2λ4,1,3-benzothiadiazin-3-yl]-N-methylpropan-1-amine;hydrochloride.
| Compound Name | 3-[2,2-dihydroxy-1-(4-methylphenyl)-4H-2λ4,1,3-benzothiadiazin-3-yl]-N-methylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 68583718 |
| Molecular Formula | C18H26ClN3O2S |
| Molecular Weight | 383.95 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 3-[2,2-dihydroxy-1-(4-methylphenyl)-4H-2λ4,1,3-benzothiadiazin-3-yl]-N-methylpropan-1-amine;hydrochloride |
| SMILES | CNCCCN1Cc2ccccc2N(c2ccc(C)cc2)S1(O)O.Cl |
| InChI | InChI=1S/C18H25N3O2S.ClH/c1-15-8-10-17(11-9-15)21-18-7-4-3-6-16(18)14-20(24(21,22)23)13-5-12-19-2;/h3-4,6-11,19,22-23H,5,12-14H2,1-2H3;1H |
| InChIKey | LEOCUXPMJADQEO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.95 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|