C18H22N2O2S2 — CID 25109328
N-methyl-3-[1-(4-methylphenyl)-2,2-dioxo-2λ6,4,1-benzodithiazin-3-yl]propan-1-amine (PubChem CID 25109328) has the molecular formula C18H22N2O2S2 and a molecular weight of 362.52 g/mol. Its IUPAC name is N-methyl-3-[1-(4-methylphenyl)-2,2-dioxo-2λ6,4,1-benzodithiazin-3-yl]propan-1-amine.
| Compound Name | N-methyl-3-[1-(4-methylphenyl)-2,2-dioxo-2λ6,4,1-benzodithiazin-3-yl]propan-1-amine |
|---|---|
| PubChem CID | 25109328 |
| Molecular Formula | C18H22N2O2S2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | N-methyl-3-[1-(4-methylphenyl)-2,2-dioxo-2λ6,4,1-benzodithiazin-3-yl]propan-1-amine |
| SMILES | CNCCCC1Sc2ccccc2N(c2ccc(C)cc2)S1(=O)=O |
| InChI | InChI=1S/C18H22N2O2S2/c1-14-9-11-15(12-10-14)20-16-6-3-4-7-17(16)23-18(24(20,21)22)8-5-13-19-2/h3-4,6-7,9-12,18-19H,5,8,13H2,1-2H3 |
| InChIKey | IJPYDPJXMCVGDZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|