C21H23ClN2O3S — CID 69260301
N-methyl-3-(1-naphthalen-2-yl-2,2-dioxo-4,2λ6,1-benzoxathiazin-3-yl)propan-1-amine;hydrochloride (PubChem CID 69260301) has the molecular formula C21H23ClN2O3S and a molecular weight of 418.95 g/mol. Its IUPAC name is N-methyl-3-(1-naphthalen-2-yl-2,2-dioxo-4,2λ6,1-benzoxathiazin-3-yl)propan-1-amine;hydrochloride.
| Compound Name | N-methyl-3-(1-naphthalen-2-yl-2,2-dioxo-4,2λ6,1-benzoxathiazin-3-yl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 69260301 |
| Molecular Formula | C21H23ClN2O3S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | N-methyl-3-(1-naphthalen-2-yl-2,2-dioxo-4,2λ6,1-benzoxathiazin-3-yl)propan-1-amine;hydrochloride |
| SMILES | CNCCCC1Oc2ccccc2N(c2ccc3ccccc3c2)S1(=O)=O.Cl |
| InChI | InChI=1S/C21H22N2O3S.ClH/c1-22-14-6-11-21-26-20-10-5-4-9-19(20)23(27(21,24)25)18-13-12-16-7-2-3-8-17(16)15-18;/h2-5,7-10,12-13,15,21-22H,6,11,14H2,1H3;1H |
| InChIKey | PJYLNYWTYMVWPR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|