C19H25ClN2O3S — CID 69260811
3-(2,2-dioxo-1-phenyl-4,2λ6,1-benzoxathiazin-3-yl)-N-propan-2-ylpropan-1-amine;hydrochloride (PubChem CID 69260811) has the molecular formula C19H25ClN2O3S and a molecular weight of 396.94 g/mol. Its IUPAC name is 3-(2,2-dioxo-1-phenyl-4,2λ6,1-benzoxathiazin-3-yl)-N-propan-2-ylpropan-1-amine;hydrochloride.
| Compound Name | 3-(2,2-dioxo-1-phenyl-4,2λ6,1-benzoxathiazin-3-yl)-N-propan-2-ylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 69260811 |
| Molecular Formula | C19H25ClN2O3S |
| Molecular Weight | 396.94 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 3-(2,2-dioxo-1-phenyl-4,2λ6,1-benzoxathiazin-3-yl)-N-propan-2-ylpropan-1-amine;hydrochloride |
| SMILES | CC(C)NCCCC1Oc2ccccc2N(c2ccccc2)S1(=O)=O.Cl |
| InChI | InChI=1S/C19H24N2O3S.ClH/c1-15(2)20-14-8-13-19-24-18-12-7-6-11-17(18)21(25(19,22)23)16-9-4-3-5-10-16;/h3-7,9-12,15,19-20H,8,13-14H2,1-2H3;1H |
| InChIKey | WZLYQDSSGALOQZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.94 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|