C18H24N2O4S — CID 69273130
3-[2,2-dihydroxy-1-(4-methoxyphenyl)-4,2λ4,1-benzoxathiazin-3-yl]-N-methylpropan-1-amine (PubChem CID 69273130) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is 3-[2,2-dihydroxy-1-(4-methoxyphenyl)-4,2λ4,1-benzoxathiazin-3-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[2,2-dihydroxy-1-(4-methoxyphenyl)-4,2λ4,1-benzoxathiazin-3-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 69273130 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 3-[2,2-dihydroxy-1-(4-methoxyphenyl)-4,2λ4,1-benzoxathiazin-3-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCC1Oc2ccccc2N(c2ccc(OC)cc2)S1(O)O |
| InChI | InChI=1S/C18H24N2O4S/c1-19-13-5-8-18-24-17-7-4-3-6-16(17)20(25(18,21)22)14-9-11-15(23-2)12-10-14/h3-4,6-7,9-12,18-19,21-22H,5,8,13H2,1-2H3 |
| InChIKey | KGDBTFXGESEMDP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|