C17H21FN2O3S — CID 69260040
3-[1-(2-fluorophenyl)-2,2-dihydroxy-4,2λ4,1-benzoxathiazin-3-yl]-N-methylpropan-1-amine (PubChem CID 69260040) has the molecular formula C17H21FN2O3S and a molecular weight of 352.43 g/mol. Its IUPAC name is 3-[1-(2-fluorophenyl)-2,2-dihydroxy-4,2λ4,1-benzoxathiazin-3-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[1-(2-fluorophenyl)-2,2-dihydroxy-4,2λ4,1-benzoxathiazin-3-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 69260040 |
| Molecular Formula | C17H21FN2O3S |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 3-[1-(2-fluorophenyl)-2,2-dihydroxy-4,2λ4,1-benzoxathiazin-3-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCC1Oc2ccccc2N(c2ccccc2F)S1(O)O |
| InChI | InChI=1S/C17H21FN2O3S/c1-19-12-6-11-17-23-16-10-5-4-9-15(16)20(24(17,21)22)14-8-3-2-7-13(14)18/h2-5,7-10,17,19,21-22H,6,11-12H2,1H3 |
| InChIKey | JPBMFAPJAPOZPO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|