C20H23N3O3S — CID 69261288
3-(2,2-dihydroxy-1-quinolin-3-yl-4,2λ4,1-benzoxathiazin-3-yl)-N-methylpropan-1-amine (PubChem CID 69261288) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is 3-(2,2-dihydroxy-1-quinolin-3-yl-4,2λ4,1-benzoxathiazin-3-yl)-N-methylpropan-1-amine.
| Compound Name | 3-(2,2-dihydroxy-1-quinolin-3-yl-4,2λ4,1-benzoxathiazin-3-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 69261288 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 3-(2,2-dihydroxy-1-quinolin-3-yl-4,2λ4,1-benzoxathiazin-3-yl)-N-methylpropan-1-amine |
| SMILES | CNCCCC1Oc2ccccc2N(c2cnc3ccccc3c2)S1(O)O |
| InChI | InChI=1S/C20H23N3O3S/c1-21-12-6-11-20-26-19-10-5-4-9-18(19)23(27(20,24)25)16-13-15-7-2-3-8-17(15)22-14-16/h2-5,7-10,13-14,20-21,24-25H,6,11-12H2,1H3 |
| InChIKey | JRDXSURUUWUQRD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|