C18H25ClN2O2S2 — CID 87757307
3-[2,2-dihydroxy-1-(4-methylphenyl)-2λ4,4,1-benzodithiazin-3-yl]-N-methylpropan-1-amine;hydrochloride (PubChem CID 87757307) has the molecular formula C18H25ClN2O2S2 and a molecular weight of 401.00 g/mol. Its IUPAC name is 3-[2,2-dihydroxy-1-(4-methylphenyl)-2λ4,4,1-benzodithiazin-3-yl]-N-methylpropan-1-amine;hydrochloride.
| Compound Name | 3-[2,2-dihydroxy-1-(4-methylphenyl)-2λ4,4,1-benzodithiazin-3-yl]-N-methylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 87757307 |
| Molecular Formula | C18H25ClN2O2S2 |
| Molecular Weight | 401.00 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 3-[2,2-dihydroxy-1-(4-methylphenyl)-2λ4,4,1-benzodithiazin-3-yl]-N-methylpropan-1-amine;hydrochloride |
| SMILES | CNCCCC1Sc2ccccc2N(c2ccc(C)cc2)S1(O)O.Cl |
| InChI | InChI=1S/C18H24N2O2S2.ClH/c1-14-9-11-15(12-10-14)20-16-6-3-4-7-17(16)23-18(24(20,21)22)8-5-13-19-2;/h3-4,6-7,9-12,18-19,21-22H,5,8,13H2,1-2H3;1H |
| InChIKey | BMPRANIKMIGFMM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.00 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|