C18H21FN2O — CID 143696271
3-[1-(2-fluorophenyl)-3,4-dihydro-2,1-benzoxazin-3-yl]-N-methylpropan-1-amine (PubChem CID 143696271) has the molecular formula C18H21FN2O and a molecular weight of 300.38 g/mol. Its IUPAC name is 3-[1-(2-fluorophenyl)-3,4-dihydro-2,1-benzoxazin-3-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[1-(2-fluorophenyl)-3,4-dihydro-2,1-benzoxazin-3-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 143696271 |
| Molecular Formula | C18H21FN2O |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 3-[1-(2-fluorophenyl)-3,4-dihydro-2,1-benzoxazin-3-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCC1Cc2ccccc2N(c2ccccc2F)O1 |
| InChI | InChI=1S/C18H21FN2O/c1-20-12-6-8-15-13-14-7-2-4-10-17(14)21(22-15)18-11-5-3-9-16(18)19/h2-5,7,9-11,15,20H,6,8,12-13H2,1H3 |
| InChIKey | FUKUUAHLABDHJT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|