C15H20N4O4S — CID 25028187
methyl 2-(1-methyl-4-nitrososulfanylpiperidin-4-yl)-2-(pyridine-3-carbonylamino)acetate (PubChem CID 25028187) has the molecular formula C15H20N4O4S and a molecular weight of 352.42 g/mol. Its IUPAC name is methyl 2-(1-methyl-4-nitrososulfanylpiperidin-4-yl)-2-(pyridine-3-carbonylamino)acetate.
| Compound Name | methyl 2-(1-methyl-4-nitrososulfanylpiperidin-4-yl)-2-(pyridine-3-carbonylamino)acetate |
|---|---|
| PubChem CID | 25028187 |
| Molecular Formula | C15H20N4O4S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | methyl 2-(1-methyl-4-nitrososulfanylpiperidin-4-yl)-2-(pyridine-3-carbonylamino)acetate |
| SMILES | COC(=O)C(NC(=O)c1cccnc1)C1(SN=O)CCN(C)CC1 |
| InChI | InChI=1S/C15H20N4O4S/c1-19-8-5-15(6-9-19,24-18-22)12(14(21)23-2)17-13(20)11-4-3-7-16-10-11/h3-4,7,10,12H,5-6,8-9H2,1-2H3,(H,17,20) |
| InChIKey | KXYXFUWOIZHHJF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|