C16H11NO5 — CID 25030054
(E)-3-[5-[(Z)-(3-oxo-4H-1,4-benzoxazin-2-ylidene)methyl]furan-2-yl]prop-2-enoic acid (PubChem CID 25030054) has the molecular formula C16H11NO5 and a molecular weight of 297.27 g/mol. Its IUPAC name is (E)-3-[5-[(Z)-(3-oxo-4H-1,4-benzoxazin-2-ylidene)methyl]furan-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[(Z)-(3-oxo-4H-1,4-benzoxazin-2-ylidene)methyl]furan-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 25030054 |
| Molecular Formula | C16H11NO5 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | (E)-3-[5-[(Z)-(3-oxo-4H-1,4-benzoxazin-2-ylidene)methyl]furan-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(/C=C2\Oc3ccccc3NC2=O)o1 |
| InChI | InChI=1S/C16H11NO5/c18-15(19)8-7-10-5-6-11(21-10)9-14-16(20)17-12-3-1-2-4-13(12)22-14/h1-9H,(H,17,20)(H,18,19)/b8-7+,14-9- |
| InChIKey | QYMGFXUIWSRNLG-ZHCWNNSNSA-N |
| XLogP | 2.75 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|