C24H20N2O4 — CID 25028415
(E)-N-(3,5-dimethylphenyl)-3-[5-[(Z)-(3-oxo-4H-1,4-benzoxazin-2-ylidene)methyl]furan-2-yl]prop-2-enamide (PubChem CID 25028415) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is (E)-N-(3,5-dimethylphenyl)-3-[5-[(Z)-(3-oxo-4H-1,4-benzoxazin-2-ylidene)methyl]furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-(3,5-dimethylphenyl)-3-[5-[(Z)-(3-oxo-4H-1,4-benzoxazin-2-ylidene)methyl]furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 25028415 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | (E)-N-(3,5-dimethylphenyl)-3-[5-[(Z)-(3-oxo-4H-1,4-benzoxazin-2-ylidene)methyl]furan-2-yl]prop-2-enamide |
| SMILES | Cc1cc(C)cc(NC(=O)/C=C/c2ccc(/C=C3\Oc4ccccc4NC3=O)o2)c1 |
| InChI | InChI=1S/C24H20N2O4/c1-15-11-16(2)13-17(12-15)25-23(27)10-9-18-7-8-19(29-18)14-22-24(28)26-20-5-3-4-6-21(20)30-22/h3-14H,1-2H3,(H,25,27)(H,26,28)/b10-9+,22-14- |
| InChIKey | NATNANQNWWXJKG-HVGQGRDZSA-N |
| XLogP | 4.92 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|