C19H19N5O4 — CID 25030683
5-hydroxy-3-[[4-[(2-methoxyphenyl)carbamoylamino]phenyl]methyl]imidazole-4-carboxamide (PubChem CID 25030683) has the molecular formula C19H19N5O4 and a molecular weight of 381.39 g/mol. Its IUPAC name is 5-hydroxy-3-[[4-[(2-methoxyphenyl)carbamoylamino]phenyl]methyl]imidazole-4-carboxamide.
| Compound Name | 5-hydroxy-3-[[4-[(2-methoxyphenyl)carbamoylamino]phenyl]methyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 25030683 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 5-hydroxy-3-[[4-[(2-methoxyphenyl)carbamoylamino]phenyl]methyl]imidazole-4-carboxamide |
| SMILES | COc1ccccc1NC(=O)Nc1ccc(Cn2cnc(O)c2C(N)=O)cc1 |
| InChI | InChI=1S/C19H19N5O4/c1-28-15-5-3-2-4-14(15)23-19(27)22-13-8-6-12(7-9-13)10-24-11-21-18(26)16(24)17(20)25/h2-9,11,26H,10H2,1H3,(H2,20,25)(H2,22,23,27) |
| InChIKey | DKOPDBGEBMOPNF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |