C23H18N4OS — CID 25031375
5-(4-imidazol-1-ylphenyl)-4-(4-methoxyphenyl)-2-thiophen-2-yl-1H-imidazole (PubChem CID 25031375) has the molecular formula C23H18N4OS and a molecular weight of 398.49 g/mol. Its IUPAC name is 5-(4-imidazol-1-ylphenyl)-4-(4-methoxyphenyl)-2-thiophen-2-yl-1H-imidazole.
| Compound Name | 5-(4-imidazol-1-ylphenyl)-4-(4-methoxyphenyl)-2-thiophen-2-yl-1H-imidazole |
|---|---|
| PubChem CID | 25031375 |
| Molecular Formula | C23H18N4OS |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 5-(4-imidazol-1-ylphenyl)-4-(4-methoxyphenyl)-2-thiophen-2-yl-1H-imidazole |
| SMILES | COc1ccc(-c2nc(-c3cccs3)[nH]c2-c2ccc(-n3ccnc3)cc2)cc1 |
| InChI | InChI=1S/C23H18N4OS/c1-28-19-10-6-17(7-11-19)22-21(25-23(26-22)20-3-2-14-29-20)16-4-8-18(9-5-16)27-13-12-24-15-27/h2-15H,1H3,(H,25,26) |
| InChIKey | XYSFZDFCHPVSIJ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|