C19H16N4O2 — CID 58910566
4-(4-imidazol-1-ylphenyl)-N-(4-methoxyphenyl)-1,3-oxazol-2-amine (PubChem CID 58910566) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 4-(4-imidazol-1-ylphenyl)-N-(4-methoxyphenyl)-1,3-oxazol-2-amine.
| Compound Name | 4-(4-imidazol-1-ylphenyl)-N-(4-methoxyphenyl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 58910566 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 4-(4-imidazol-1-ylphenyl)-N-(4-methoxyphenyl)-1,3-oxazol-2-amine |
| SMILES | COc1ccc(Nc2nc(-c3ccc(-n4ccnc4)cc3)co2)cc1 |
| InChI | InChI=1S/C19H16N4O2/c1-24-17-8-4-15(5-9-17)21-19-22-18(12-25-19)14-2-6-16(7-3-14)23-11-10-20-13-23/h2-13H,1H3,(H,21,22) |
| InChIKey | HEWFZFDGDJSVHH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |