C19H22O3 — CID 25033850
ethyl 6-(2-methyl-1-oxo-3,4-dihydronaphthalen-2-yl)hex-2-ynoate (PubChem CID 25033850) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is ethyl 6-(2-methyl-1-oxo-3,4-dihydronaphthalen-2-yl)hex-2-ynoate.
| Compound Name | ethyl 6-(2-methyl-1-oxo-3,4-dihydronaphthalen-2-yl)hex-2-ynoate |
|---|---|
| PubChem CID | 25033850 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | ethyl 6-(2-methyl-1-oxo-3,4-dihydronaphthalen-2-yl)hex-2-ynoate |
| SMILES | CCOC(=O)C#CCCCC1(C)CCc2ccccc2C1=O |
| InChI | InChI=1S/C19H22O3/c1-3-22-17(20)11-5-4-8-13-19(2)14-12-15-9-6-7-10-16(15)18(19)21/h6-7,9-10H,3-4,8,12-14H2,1-2H3 |
| InChIKey | CPBXMHCCOJIZIS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|