C23H29N5O3S — CID 25036730
1-(1-adamantylmethyl)-3-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]urea (PubChem CID 25036730) has the molecular formula C23H29N5O3S and a molecular weight of 455.58 g/mol. Its IUPAC name is 1-(1-adamantylmethyl)-3-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]urea.
| Compound Name | 1-(1-adamantylmethyl)-3-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]urea |
|---|---|
| PubChem CID | 25036730 |
| Molecular Formula | C23H29N5O3S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 1-(1-adamantylmethyl)-3-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]urea |
| SMILES | Cc1ccnc(NS(=O)(=O)c2ccc(NC(=O)NCC34CC5CC(CC(C5)C3)C4)cc2)n1 |
| InChI | InChI=1S/C23H29N5O3S/c1-15-6-7-24-21(26-15)28-32(30,31)20-4-2-19(3-5-20)27-22(29)25-14-23-11-16-8-17(12-23)10-18(9-16)13-23/h2-7,16-18H,8-14H2,1H3,(H,24,26,28)(H2,25,27,29) |
| InChIKey | CCFOXGXIHQYYQB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |