C23H19NO5S — CID 25037495
N-[3-(2,7-dihydroxynaphthalen-1-yl)-4-hydroxyphenyl]-4-methylbenzenesulfonamide (PubChem CID 25037495) has the molecular formula C23H19NO5S and a molecular weight of 421.47 g/mol. Its IUPAC name is N-[3-(2,7-dihydroxynaphthalen-1-yl)-4-hydroxyphenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-(2,7-dihydroxynaphthalen-1-yl)-4-hydroxyphenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 25037495 |
| Molecular Formula | C23H19NO5S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-[3-(2,7-dihydroxynaphthalen-1-yl)-4-hydroxyphenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(O)c(-c3c(O)ccc4ccc(O)cc34)c2)cc1 |
| InChI | InChI=1S/C23H19NO5S/c1-14-2-8-18(9-3-14)30(28,29)24-16-6-11-21(26)20(12-16)23-19-13-17(25)7-4-15(19)5-10-22(23)27/h2-13,24-27H,1H3 |
| InChIKey | SWCWAOGTSTZFLV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|