C23H19N3O4S2 — CID 25044147
(2-anilino-1,3-thiazol-4-yl)methyl 4-(phenylsulfamoyl)benzoate (PubChem CID 25044147) has the molecular formula C23H19N3O4S2 and a molecular weight of 465.56 g/mol. Its IUPAC name is (2-anilino-1,3-thiazol-4-yl)methyl 4-(phenylsulfamoyl)benzoate.
| Compound Name | (2-anilino-1,3-thiazol-4-yl)methyl 4-(phenylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 25044147 |
| Molecular Formula | C23H19N3O4S2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | (2-anilino-1,3-thiazol-4-yl)methyl 4-(phenylsulfamoyl)benzoate |
| SMILES | O=C(OCc1csc(Nc2ccccc2)n1)c1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C23H19N3O4S2/c27-22(30-15-20-16-31-23(25-20)24-18-7-3-1-4-8-18)17-11-13-21(14-12-17)32(28,29)26-19-9-5-2-6-10-19/h1-14,16,26H,15H2,(H,24,25) |
| InChIKey | KJQHFOMYWPPNOV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |