C16H13N3O2S — CID 2097661
(2-anilino-1,3-thiazol-4-yl)methyl pyridine-3-carboxylate (PubChem CID 2097661) has the molecular formula C16H13N3O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is (2-anilino-1,3-thiazol-4-yl)methyl pyridine-3-carboxylate.
| Compound Name | (2-anilino-1,3-thiazol-4-yl)methyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 2097661 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | (2-anilino-1,3-thiazol-4-yl)methyl pyridine-3-carboxylate |
| SMILES | O=C(OCc1csc(Nc2ccccc2)n1)c1cccnc1 |
| InChI | InChI=1S/C16H13N3O2S/c20-15(12-5-4-8-17-9-12)21-10-14-11-22-16(19-14)18-13-6-2-1-3-7-13/h1-9,11H,10H2,(H,18,19) |
| InChIKey | RDENAKGLTMDFNU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |