About (2-anilino-1,3-thiazol-4-yl)methyl 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate
(2-anilino-1,3-thiazol-4-yl)methyl 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate (PubChem CID 55491145) has the molecular formula C20H19N5O2S
and a molecular weight of 393.47 g/mol. Its IUPAC name is (2-anilino-1,3-thiazol-4-yl)methyl 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate.
Molecular Properties
| Compound Name | (2-anilino-1,3-thiazol-4-yl)methyl 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate |
| PubChem CID | 55491145 |
| Molecular Formula | C20H19N5O2S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | (2-anilino-1,3-thiazol-4-yl)methyl 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate |
| SMILES | CC(C)n1ncc2cc(C(=O)OCc3csc(Nc4ccccc4)n3)cnc21 |
| InChI | InChI=1S/C20H19N5O2S/c1-13(2)25-18-14(10-22-25)8-15(9-21-18)19(26)27-11-17-12-28-20(24-17)23-16-6-4-3-5-7-16/h3-10,12-13H,11H2,1-2H3,(H,23,24) |
| InChIKey | FMERZJJZPSZVFF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (2-anilino-1,3-thiazol-4-yl)methyl 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-anilino-1,3-thiazol-4-yl)methyl 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate?
The IUPAC name of (2-anilino-1,3-thiazol-4-yl)methyl 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate (CID 55491145) is (2-anilino-1,3-thiazol-4-yl)methyl 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate.
What is the SMILES notation for (2-anilino-1,3-thiazol-4-yl)methyl 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate?
The canonical SMILES for (2-anilino-1,3-thiazol-4-yl)methyl 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate is CC(C)n1ncc2cc(C(=O)OCc3csc(Nc4ccccc4)n3)cnc21.
What is the InChIKey of (2-anilino-1,3-thiazol-4-yl)methyl 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate?
The InChIKey is FMERZJJZPSZVFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N5O2S/c1-13(2)25-18-14(10-22-25)8-15(9-21-18)19(26)27-11-17-12-28-20(24-17)23-16-6-4-3-5-7-16/h3-10,12-13H,11H2,1-2H3,(H,23,24).
What are the key properties of (2-anilino-1,3-thiazol-4-yl)methyl 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate?
(2-anilino-1,3-thiazol-4-yl)methyl 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate has a molecular weight of 393.47 g/mol, XLogP of 4.57, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2-anilino-1,3-thiazol-4-yl)methyl 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate is sourced from PubChem (CID 55491145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).