C27H23Cl2N5O8S — CID 25047193
[1-(3-nitroanilino)-1-oxopropan-2-yl] 2,4-dichloro-5-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)sulfamoyl]benzoate (PubChem CID 25047193) has the molecular formula C27H23Cl2N5O8S and a molecular weight of 648.48 g/mol. Its IUPAC name is [1-(3-nitroanilino)-1-oxopropan-2-yl] 2,4-dichloro-5-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)sulfamoyl]benzoate.
| Compound Name | [1-(3-nitroanilino)-1-oxopropan-2-yl] 2,4-dichloro-5-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 25047193 |
| Molecular Formula | C27H23Cl2N5O8S |
| Molecular Weight | 648.48 g/mol |
| Exact Mass | 647.06 |
| IUPAC Name | [1-(3-nitroanilino)-1-oxopropan-2-yl] 2,4-dichloro-5-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)sulfamoyl]benzoate |
| SMILES | Cc1c(NS(=O)(=O)c2cc(C(=O)OC(C)C(=O)Nc3cccc([N+](=O)[O-])c3)c(Cl)cc2Cl)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C27H23Cl2N5O8S/c1-15-24(26(36)33(32(15)3)18-9-5-4-6-10-18)31-43(40,41)23-13-20(21(28)14-22(23)29)27(37)42-16(2)25(35)30-17-8-7-11-19(12-17)34(38)39/h4-14,16,31H,1-3H3,(H,30,35) |
| InChIKey | YTQBRGXHXSKBTP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 171.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|