C16H14BrN3O3S2 — CID 25047813
5-bromo-2-methoxy-N-[[4-(thiadiazol-4-yl)phenyl]methyl]benzenesulfonamide (PubChem CID 25047813) has the molecular formula C16H14BrN3O3S2 and a molecular weight of 440.34 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-[[4-(thiadiazol-4-yl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 5-bromo-2-methoxy-N-[[4-(thiadiazol-4-yl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25047813 |
| Molecular Formula | C16H14BrN3O3S2 |
| Molecular Weight | 440.34 g/mol |
| Exact Mass | 438.97 |
| IUPAC Name | 5-bromo-2-methoxy-N-[[4-(thiadiazol-4-yl)phenyl]methyl]benzenesulfonamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)NCc1ccc(-c2csnn2)cc1 |
| InChI | InChI=1S/C16H14BrN3O3S2/c1-23-15-7-6-13(17)8-16(15)25(21,22)18-9-11-2-4-12(5-3-11)14-10-24-20-19-14/h2-8,10,18H,9H2,1H3 |
| InChIKey | WSYCURJAUQELMZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |