C17H17N3O4S2 — CID 25048385
2,5-dimethoxy-N-[[4-(thiadiazol-4-yl)phenyl]methyl]benzenesulfonamide (PubChem CID 25048385) has the molecular formula C17H17N3O4S2 and a molecular weight of 391.47 g/mol. Its IUPAC name is 2,5-dimethoxy-N-[[4-(thiadiazol-4-yl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-[[4-(thiadiazol-4-yl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25048385 |
| Molecular Formula | C17H17N3O4S2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 2,5-dimethoxy-N-[[4-(thiadiazol-4-yl)phenyl]methyl]benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NCc2ccc(-c3csnn3)cc2)c1 |
| InChI | InChI=1S/C17H17N3O4S2/c1-23-14-7-8-16(24-2)17(9-14)26(21,22)18-10-12-3-5-13(6-4-12)15-11-25-20-19-15/h3-9,11,18H,10H2,1-2H3 |
| InChIKey | CQNXOVJKZDIZTL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |