C26H21N3O8 — CID 25050421
(Z)-4-[[2-[(19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl)oxy]-2-oxoethyl]amino]-4-oxobut-2-enoic acid (PubChem CID 25050421) has the molecular formula C26H21N3O8 and a molecular weight of 503.47 g/mol. Its IUPAC name is (Z)-4-[[2-[(19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl)oxy]-2-oxoethyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[[2-[(19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl)oxy]-2-oxoethyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 25050421 |
| Molecular Formula | C26H21N3O8 |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | (Z)-4-[[2-[(19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl)oxy]-2-oxoethyl]amino]-4-oxobut-2-enoic acid |
| SMILES | CCC1(OC(=O)CNC(=O)/C=C\C(=O)O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3ccccc3nc2-1 |
| InChI | InChI=1S/C26H21N3O8/c1-2-26(37-22(33)11-27-20(30)7-8-21(31)32)17-10-19-23-15(9-14-5-3-4-6-18(14)28-23)12-29(19)24(34)16(17)13-36-25(26)35/h3-10H,2,11-13H2,1H3,(H,27,30)(H,31,32)/b8-7- |
| InChIKey | YRQFVWWTSGBFLC-FPLPWBNLSA-N |
| XLogP | 1.39 |
| TPSA | 153.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|