C17H17N3O3S — CID 25053039
3-amino-4-[2-(benzenesulfonyl)-1-phenylethyl]-1,4-dihydropyrazol-5-one (PubChem CID 25053039) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is 3-amino-4-[2-(benzenesulfonyl)-1-phenylethyl]-1,4-dihydropyrazol-5-one.
| Compound Name | 3-amino-4-[2-(benzenesulfonyl)-1-phenylethyl]-1,4-dihydropyrazol-5-one |
|---|---|
| PubChem CID | 25053039 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 3-amino-4-[2-(benzenesulfonyl)-1-phenylethyl]-1,4-dihydropyrazol-5-one |
| SMILES | NC1=NNC(=O)C1C(CS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H17N3O3S/c18-16-15(17(21)20-19-16)14(12-7-3-1-4-8-12)11-24(22,23)13-9-5-2-6-10-13/h1-10,14-15H,11H2,(H2,18,19)(H,20,21) |
| InChIKey | WTFSAADNTYKBOZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |